C10H8N6O2 — CID 146541479
6-(3H-benzimidazol-5-ylamino)-1H-1,3,5-triazine-2,4-dione (PubChem CID 146541479) has the molecular formula C10H8N6O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 6-(3H-benzimidazol-5-ylamino)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(3H-benzimidazol-5-ylamino)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 146541479 |
| Molecular Formula | C10H8N6O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 6-(3H-benzimidazol-5-ylamino)-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(Nc2ccc3nc[nH]c3c2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H8N6O2/c17-9-14-8(15-10(18)16-9)13-5-1-2-6-7(3-5)12-4-11-6/h1-4H,(H,11,12)(H3,13,14,15,16,17,18) |
| InChIKey | QDXNYIZRPNXHOI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |