C15H14FN3O2S — CID 110759965
N-[2-(4-fluorophenyl)ethyl]-3H-benzimidazole-5-sulfonamide (PubChem CID 110759965) has the molecular formula C15H14FN3O2S and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110759965 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3H-benzimidazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(F)cc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C15H14FN3O2S/c16-12-3-1-11(2-4-12)7-8-19-22(20,21)13-5-6-14-15(9-13)18-10-17-14/h1-6,9-10,19H,7-8H2,(H,17,18) |
| InChIKey | VUFRTDZMEIWGTK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |