C16H16FN3O2S — CID 110791675
4-fluoro-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 110791675) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-fluoro-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110791675 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-fluoro-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cnc2cc(CCNS(=O)(=O)c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H16FN3O2S/c1-20-11-18-15-10-12(2-7-16(15)20)8-9-19-23(21,22)14-5-3-13(17)4-6-14/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | UQVBRNJVEDJQDS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |