C17H18FN3O2S — CID 110791682
4-fluoro-3-methyl-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 110791682) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110791682 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-fluoro-3-methyl-N-[2-(1-methylbenzimidazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCc2ccc3c(c2)ncn3C)ccc1F |
| InChI | InChI=1S/C17H18FN3O2S/c1-12-9-14(4-5-15(12)18)24(22,23)20-8-7-13-3-6-17-16(10-13)19-11-21(17)2/h3-6,9-11,20H,7-8H2,1-2H3 |
| InChIKey | JNQNEQUJGJJUNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |