C18H19FN2O3S — CID 110384490
N-[2-(4-fluorophenyl)ethyl]-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 110384490) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 110384490 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CC1(C)C(=O)Nc2ccc(S(=O)(=O)NCCc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C18H19FN2O3S/c1-18(2)15-11-14(7-8-16(15)21-17(18)22)25(23,24)20-10-9-12-3-5-13(19)6-4-12/h3-8,11,20H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | DQHXLPZDLKTDQH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |