C14H20N2O3S — CID 56687358
N-butan-2-yl-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 56687358) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-butan-2-yl-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-butan-2-yl-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 56687358 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-butan-2-yl-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C14H20N2O3S/c1-5-9(2)16-20(18,19)10-6-7-12-11(8-10)14(3,4)13(17)15-12/h6-9,16H,5H2,1-4H3,(H,15,17) |
| InChIKey | VNGJJISUJWCCRD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |