C16H15ClN2O3S — CID 110384518
N-(2-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 110384518) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-(2-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 110384518 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(2-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CC1(C)C(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3Cl)cc21 |
| InChI | InChI=1S/C16H15ClN2O3S/c1-16(2)11-9-10(7-8-13(11)18-15(16)20)23(21,22)19-14-6-4-3-5-12(14)17/h3-9,19H,1-2H3,(H,18,20) |
| InChIKey | CMCKYRPLYFRARW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |