C14H14N4O3S — CID 167808491
3,3-dimethyl-2-oxo-N-pyridazin-3-yl-1H-indole-5-sulfonamide (PubChem CID 167808491) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-N-pyridazin-3-yl-1H-indole-5-sulfonamide.
| Compound Name | 3,3-dimethyl-2-oxo-N-pyridazin-3-yl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 167808491 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3,3-dimethyl-2-oxo-N-pyridazin-3-yl-1H-indole-5-sulfonamide |
| SMILES | CC1(C)C(=O)Nc2ccc(S(=O)(=O)Nc3cccnn3)cc21 |
| InChI | InChI=1S/C14H14N4O3S/c1-14(2)10-8-9(5-6-11(10)16-13(14)19)22(20,21)18-12-4-3-7-15-17-12/h3-8H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | RUKWMSSNPVMPPG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |