C21H28N2O4S2 — CID 3130331
2-N,7-N-di(butan-2-yl)-9H-fluorene-2,7-disulfonamide (PubChem CID 3130331) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-N,7-N-di(butan-2-yl)-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-di(butan-2-yl)-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 3130331 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-N,7-N-di(butan-2-yl)-9H-fluorene-2,7-disulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc2c(c1)Cc1cc(S(=O)(=O)NC(C)CC)ccc1-2 |
| InChI | InChI=1S/C21H28N2O4S2/c1-5-14(3)22-28(24,25)18-7-9-20-16(12-18)11-17-13-19(8-10-21(17)20)29(26,27)23-15(4)6-2/h7-10,12-15,22-23H,5-6,11H2,1-4H3 |
| InChIKey | NFLOGLNDPANICS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |