C13H10Na2O6S2 — CID 88515722
CID 88515722 (PubChem CID 88515722) has the molecular formula C13H10Na2O6S2 and a molecular weight of 372.33 g/mol.
| Compound Name | CID 88515722 |
|---|---|
| PubChem CID | 88515722 |
| Molecular Formula | C13H10Na2O6S2 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2c(c1)Cc1cc(S(=O)(=O)O)ccc1-2.[Na].[Na] |
| InChI | InChI=1S/C13H10O6S2.2Na/c14-20(15,16)10-1-3-12-8(6-10)5-9-7-11(21(17,18)19)2-4-13(9)12;;/h1-4,6-7H,5H2,(H,14,15,16)(H,17,18,19);; |
| InChIKey | DFGHIKAKWPKVID-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|