C15H13FN4S — CID 25062914
1-(3H-benzimidazol-5-yl)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 25062914) has the molecular formula C15H13FN4S and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 25062914 |
| Molecular Formula | C15H13FN4S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)Nc2ccc3nc[nH]c3c2)cc1 |
| InChI | InChI=1S/C15H13FN4S/c16-11-3-1-10(2-4-11)8-17-15(21)20-12-5-6-13-14(7-12)19-9-18-13/h1-7,9H,8H2,(H,18,19)(H2,17,20,21) |
| InChIKey | MHMZFLWGVRUZQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|