C9H8ClN3O — CID 115194686
N-(3H-benzimidazol-5-ylmethyl)carbamoyl chloride (PubChem CID 115194686) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-ylmethyl)carbamoyl chloride.
| Compound Name | N-(3H-benzimidazol-5-ylmethyl)carbamoyl chloride |
|---|---|
| PubChem CID | 115194686 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | N-(3H-benzimidazol-5-ylmethyl)carbamoyl chloride |
| SMILES | O=C(Cl)NCc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C9H8ClN3O/c10-9(14)11-4-6-1-2-7-8(3-6)13-5-12-7/h1-3,5H,4H2,(H,11,14)(H,12,13) |
| InChIKey | WIKCDJYSPYWQFM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|