C17H19N3O3 — CID 154922151
(1R,2S,4R)-N-(3H-benzimidazol-5-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide;formic acid (PubChem CID 154922151) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (1R,2S,4R)-N-(3H-benzimidazol-5-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide;formic acid.
| Compound Name | (1R,2S,4R)-N-(3H-benzimidazol-5-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 154922151 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (1R,2S,4R)-N-(3H-benzimidazol-5-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide;formic acid |
| SMILES | O=C(NCc1ccc2nc[nH]c2c1)[C@H]1C[C@@H]2C=C[C@H]1C2.O=CO |
| InChI | InChI=1S/C16H17N3O.CH2O2/c20-16(13-6-10-1-3-12(13)5-10)17-8-11-2-4-14-15(7-11)19-9-18-14;2-1-3/h1-4,7,9-10,12-13H,5-6,8H2,(H,17,20)(H,18,19);1H,(H,2,3)/t10-,12+,13+;/m1./s1 |
| InChIKey | JAPYTDMOTHHDKG-QNULRCCRSA-N |
| XLogP | 2.09 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|