C15H20N4O4 — CID 154903850
2-acetamido-N-(3H-benzimidazol-5-ylmethyl)-2-methylpropanamide;formic acid (PubChem CID 154903850) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-acetamido-N-(3H-benzimidazol-5-ylmethyl)-2-methylpropanamide;formic acid.
| Compound Name | 2-acetamido-N-(3H-benzimidazol-5-ylmethyl)-2-methylpropanamide;formic acid |
|---|---|
| PubChem CID | 154903850 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-acetamido-N-(3H-benzimidazol-5-ylmethyl)-2-methylpropanamide;formic acid |
| SMILES | CC(=O)NC(C)(C)C(=O)NCc1ccc2nc[nH]c2c1.O=CO |
| InChI | InChI=1S/C14H18N4O2.CH2O2/c1-9(19)18-14(2,3)13(20)15-7-10-4-5-11-12(6-10)17-8-16-11;2-1-3/h4-6,8H,7H2,1-3H3,(H,15,20)(H,16,17)(H,18,19);1H,(H,2,3) |
| InChIKey | KMGJZZBLTLRZEI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|