C10H14N4 — CID 115226891
N'-(3H-benzimidazol-5-ylmethyl)-N-methylmethanediamine (PubChem CID 115226891) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N'-(3H-benzimidazol-5-ylmethyl)-N-methylmethanediamine.
| Compound Name | N'-(3H-benzimidazol-5-ylmethyl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 115226891 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N'-(3H-benzimidazol-5-ylmethyl)-N-methylmethanediamine |
| SMILES | CNCNCc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C10H14N4/c1-11-6-12-5-8-2-3-9-10(4-8)14-7-13-9/h2-4,7,11-12H,5-6H2,1H3,(H,13,14) |
| InChIKey | GHYIEJTVLSDHCH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|