C9H11N3S — CID 115227972
(3H-benzimidazol-5-ylmethylamino)methanethiol (PubChem CID 115227972) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is (3H-benzimidazol-5-ylmethylamino)methanethiol.
| Compound Name | (3H-benzimidazol-5-ylmethylamino)methanethiol |
|---|---|
| PubChem CID | 115227972 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3H-benzimidazol-5-ylmethylamino)methanethiol |
| SMILES | SCNCc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C9H11N3S/c13-6-10-4-7-1-2-8-9(3-7)12-5-11-8/h1-3,5,10,13H,4,6H2,(H,11,12) |
| InChIKey | KOTLKAYDXQBALK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|