C10H10N4 — CID 115131027
2-(3H-benzimidazol-5-ylmethylamino)acetonitrile (PubChem CID 115131027) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-(3H-benzimidazol-5-ylmethylamino)acetonitrile.
| Compound Name | 2-(3H-benzimidazol-5-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 115131027 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-(3H-benzimidazol-5-ylmethylamino)acetonitrile |
| SMILES | N#CCNCc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C10H10N4/c11-3-4-12-6-8-1-2-9-10(5-8)14-7-13-9/h1-2,5,7,12H,4,6H2,(H,13,14) |
| InChIKey | JIYQFCWQGRLWHY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|