C12H14N4 — CID 115231013
3-[3H-benzimidazol-5-ylmethyl(methyl)amino]propanenitrile (PubChem CID 115231013) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-[3H-benzimidazol-5-ylmethyl(methyl)amino]propanenitrile.
| Compound Name | 3-[3H-benzimidazol-5-ylmethyl(methyl)amino]propanenitrile |
|---|---|
| PubChem CID | 115231013 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-[3H-benzimidazol-5-ylmethyl(methyl)amino]propanenitrile |
| SMILES | CN(CCC#N)Cc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H14N4/c1-16(6-2-5-13)8-10-3-4-11-12(7-10)15-9-14-11/h3-4,7,9H,2,6,8H2,1H3,(H,14,15) |
| InChIKey | VDMAESBPYFCJIX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |