C14H20N4O — CID 115157341
4-amino-N-(3H-benzimidazol-5-ylmethyl)-3,3-dimethylbutanamide (PubChem CID 115157341) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-amino-N-(3H-benzimidazol-5-ylmethyl)-3,3-dimethylbutanamide.
| Compound Name | 4-amino-N-(3H-benzimidazol-5-ylmethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115157341 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-amino-N-(3H-benzimidazol-5-ylmethyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(CN)CC(=O)NCc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H20N4O/c1-14(2,8-15)6-13(19)16-7-10-3-4-11-12(5-10)18-9-17-11/h3-5,9H,6-8,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | OGZNMHMKCOFMJN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |