C15H18N2O — CID 116649982
N-[(4-aminophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 116649982) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 116649982 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[(4-aminophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Nc1ccc(CNC(=O)C2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C15H18N2O/c16-13-5-2-10(3-6-13)9-17-15(18)14-8-11-1-4-12(14)7-11/h1-6,11-12,14H,7-9,16H2,(H,17,18) |
| InChIKey | GWKKZLBHQYDWMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|