C14H10F2N4O — CID 108886039
1-(3H-benzimidazol-5-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 108886039) has the molecular formula C14H10F2N4O and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 108886039 |
| Molecular Formula | C14H10F2N4O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc2nc[nH]c2c1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H10F2N4O/c15-8-1-3-11(10(16)5-8)20-14(21)19-9-2-4-12-13(6-9)18-7-17-12/h1-7H,(H,17,18)(H2,19,20,21) |
| InChIKey | ZEOBNXHCPRICJC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |