C19H24N4O2S — CID 145497541
1-(3H-benzimidazol-5-yl)-3-[(2,3-dimethoxyphenyl)methyl]thiourea;ethane (PubChem CID 145497541) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-[(2,3-dimethoxyphenyl)methyl]thiourea;ethane.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-[(2,3-dimethoxyphenyl)methyl]thiourea;ethane |
|---|---|
| PubChem CID | 145497541 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-[(2,3-dimethoxyphenyl)methyl]thiourea;ethane |
| SMILES | CC.COc1cccc(CNC(=S)Nc2ccc3nc[nH]c3c2)c1OC |
| InChI | InChI=1S/C17H18N4O2S.C2H6/c1-22-15-5-3-4-11(16(15)23-2)9-18-17(24)21-12-6-7-13-14(8-12)20-10-19-13;1-2/h3-8,10H,9H2,1-2H3,(H,19,20)(H2,18,21,24);1-2H3 |
| InChIKey | NCDMGVVPIHSICT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|