C20H20N4O3 — CID 108526611
N'-acetyl-N'-(3-aminophenyl)-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 108526611) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108526611 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | CC(=O)N(C(=O)C(=O)NCCc1c[nH]c2ccccc12)c1cccc(N)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-13(25)24(16-6-4-5-15(21)11-16)20(27)19(26)22-10-9-14-12-23-18-8-3-2-7-17(14)18/h2-8,11-12,23H,9-10,21H2,1H3,(H,22,26) |
| InChIKey | RTHZZBVJSPJMDG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|