C22H27N5O2 — CID 10293991
2-(3-amino-N-methylanilino)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]propanamide (PubChem CID 10293991) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(3-amino-N-methylanilino)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]propanamide.
| Compound Name | 2-(3-amino-N-methylanilino)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 10293991 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-(3-amino-N-methylanilino)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]propanamide |
| SMILES | CC(C(=O)NCC(=O)NCCc1c[nH]c2ccccc12)N(C)c1cccc(N)c1 |
| InChI | InChI=1S/C22H27N5O2/c1-15(27(2)18-7-5-6-17(23)12-18)22(29)26-14-21(28)24-11-10-16-13-25-20-9-4-3-8-19(16)20/h3-9,12-13,15,25H,10-11,14,23H2,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | MFMKSFVNHXKGHW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|