C23H27N5O3 — CID 85326022
3-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide (PubChem CID 85326022) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide.
| Compound Name | 3-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 85326022 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide |
| SMILES | CC(Cc1cccc(C(N)=NO)c1)C(=O)NCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H27N5O3/c1-15(11-16-5-4-6-17(12-16)22(24)28-31)23(30)27-14-21(29)25-10-9-18-13-26-20-8-3-2-7-19(18)20/h2-8,12-13,15,26,31H,9-11,14H2,1H3,(H2,24,28)(H,25,29)(H,27,30) |
| InChIKey | YSPUAFMAYXRVGO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|