C24H29N5O3 — CID 10224952
3-(5-carbamimidoyl-2-methoxyphenyl)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide (PubChem CID 10224952) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(5-carbamimidoyl-2-methoxyphenyl)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide.
| Compound Name | 3-(5-carbamimidoyl-2-methoxyphenyl)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 10224952 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 3-(5-carbamimidoyl-2-methoxyphenyl)-N-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-2-methylpropanamide |
| SMILES | [H]/N=C(\N)c1ccc(OC)c(CC(C)C(=O)NCC(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H29N5O3/c1-15(11-18-12-16(23(25)26)7-8-21(18)32-2)24(31)29-14-22(30)27-10-9-17-13-28-20-6-4-3-5-19(17)20/h3-8,12-13,15,28H,9-11,14H2,1-2H3,(H3,25,26)(H,27,30)(H,29,31) |
| InChIKey | UKYYDZZLNWNAFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|