C17H26N4O — CID 108995075
2-[3-(dimethylamino)propylamino]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 108995075) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[3-(dimethylamino)propylamino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 108995075 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CN(C)CCCNCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H26N4O/c1-21(2)11-5-9-18-13-17(22)19-10-8-14-12-20-16-7-4-3-6-15(14)16/h3-4,6-7,12,18,20H,5,8-11,13H2,1-2H3,(H,19,22) |
| InChIKey | ZISRYJRTUUHEPV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|