C19H26N4O2 — CID 108973434
1-N'-[2-(dimethylamino)ethyl]-1-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108973434) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-N'-[2-(dimethylamino)ethyl]-1-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-(dimethylamino)ethyl]-1-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973434 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-N'-[2-(dimethylamino)ethyl]-1-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | CN(C)CCNC(=O)C1(C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H26N4O2/c1-23(2)12-11-21-18(25)19(8-9-19)17(24)20-10-7-14-13-22-16-6-4-3-5-15(14)16/h3-6,13,22H,7-12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | OXBVDJRTWMQVBB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|