C20H27N3O2 — CID 108978254
1-N-[2-(1H-indol-3-yl)ethyl]-1-N'-(3-methylbutyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108978254) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-N-[2-(1H-indol-3-yl)ethyl]-1-N'-(3-methylbutyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[2-(1H-indol-3-yl)ethyl]-1-N'-(3-methylbutyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978254 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-N-[2-(1H-indol-3-yl)ethyl]-1-N'-(3-methylbutyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)CCNC(=O)C1(C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-14(2)7-11-21-18(24)20(9-10-20)19(25)22-12-8-15-13-23-17-6-4-3-5-16(15)17/h3-6,13-14,23H,7-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | OURXKYHMXGJFCF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|