C10H15N5O2 — CID 83121373
1-(4-aminophenyl)-3-[2-(carbamoylamino)ethyl]urea (PubChem CID 83121373) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[2-(carbamoylamino)ethyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[2-(carbamoylamino)ethyl]urea |
|---|---|
| PubChem CID | 83121373 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(4-aminophenyl)-3-[2-(carbamoylamino)ethyl]urea |
| SMILES | NC(=O)NCCNC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C10H15N5O2/c11-7-1-3-8(4-2-7)15-10(17)14-6-5-13-9(12)16/h1-4H,5-6,11H2,(H3,12,13,16)(H2,14,15,17) |
| InChIKey | NFCKUYJRPBSIRK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|