C14H20FN3O3 — CID 134003769
2-(3-ethoxypropylcarbamoylamino)-N-(4-fluorophenyl)acetamide (PubChem CID 134003769) has the molecular formula C14H20FN3O3 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(3-ethoxypropylcarbamoylamino)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(3-ethoxypropylcarbamoylamino)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 134003769 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(3-ethoxypropylcarbamoylamino)-N-(4-fluorophenyl)acetamide |
| SMILES | CCOCCCNC(=O)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3O3/c1-2-21-9-3-8-16-14(20)17-10-13(19)18-12-6-4-11(15)5-7-12/h4-7H,2-3,8-10H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | PHSTZMRDMKSCJA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|