C15H22N2O3 — CID 2209969
N-(3-ethoxypropyl)-N'-[(4-methylphenyl)methyl]oxamide (PubChem CID 2209969) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N'-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N-(3-ethoxypropyl)-N'-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 2209969 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(3-ethoxypropyl)-N'-[(4-methylphenyl)methyl]oxamide |
| SMILES | CCOCCCNC(=O)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-3-20-10-4-9-16-14(18)15(19)17-11-13-7-5-12(2)6-8-13/h5-8H,3-4,9-11H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | DGSJCFZFKVJNCK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|