C12H31NO — CID 144519642
ethane;4-ethoxy-N,N-dimethylbutan-1-amine (PubChem CID 144519642) has the molecular formula C12H31NO and a molecular weight of 205.39 g/mol. Its IUPAC name is ethane;4-ethoxy-N,N-dimethylbutan-1-amine.
| Compound Name | ethane;4-ethoxy-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 144519642 |
| Molecular Formula | C12H31NO |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.24 |
| IUPAC Name | ethane;4-ethoxy-N,N-dimethylbutan-1-amine |
| SMILES | CC.CC.CCOCCCCN(C)C |
| InChI | InChI=1S/C8H19NO.2C2H6/c1-4-10-8-6-5-7-9(2)3;2*1-2/h4-8H2,1-3H3;2*1-2H3 |
| InChIKey | LOVHESXNKYESPJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|