C13H30N2O — CID 71335921
6-[3-(dimethylamino)propoxy]-N,N-dimethylhexan-1-amine (PubChem CID 71335921) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]-N,N-dimethylhexan-1-amine.
| Compound Name | 6-[3-(dimethylamino)propoxy]-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 71335921 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]-N,N-dimethylhexan-1-amine |
| SMILES | CN(C)CCCCCCOCCCN(C)C |
| InChI | InChI=1S/C13H30N2O/c1-14(2)10-7-5-6-8-12-16-13-9-11-15(3)4/h5-13H2,1-4H3 |
| InChIKey | XZWHVGHSTRWWKX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|