C7H18N2O — CID 56993773
3-(2-aminoethoxy)-N,N-dimethylpropan-1-amine (PubChem CID 56993773) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-aminoethoxy)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 56993773 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 3-(2-aminoethoxy)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOCCN |
| InChI | InChI=1S/C7H18N2O/c1-9(2)5-3-6-10-7-4-8/h3-8H2,1-2H3 |
| InChIKey | AZFISYYFLQRUFX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|