C24H52N2O2 — CID 154134188
5-[10-[5-(dimethylamino)pentoxy]decoxy]-N,N-dimethylpentan-1-amine (PubChem CID 154134188) has the molecular formula C24H52N2O2 and a molecular weight of 400.69 g/mol. Its IUPAC name is 5-[10-[5-(dimethylamino)pentoxy]decoxy]-N,N-dimethylpentan-1-amine.
| Compound Name | 5-[10-[5-(dimethylamino)pentoxy]decoxy]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 154134188 |
| Molecular Formula | C24H52N2O2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.40 |
| IUPAC Name | 5-[10-[5-(dimethylamino)pentoxy]decoxy]-N,N-dimethylpentan-1-amine |
| SMILES | CN(C)CCCCCOCCCCCCCCCCOCCCCCN(C)C |
| InChI | InChI=1S/C24H52N2O2/c1-25(2)19-13-11-17-23-27-21-15-9-7-5-6-8-10-16-22-28-24-18-12-14-20-26(3)4/h5-24H2,1-4H3 |
| InChIKey | BLXUVCIQOXWQOW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|