C8H11N3O2 — CID 43316269
N-(cyanomethyl)-N'-cyclopropyl-N'-methyloxamide (PubChem CID 43316269) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-cyclopropyl-N'-methyloxamide.
| Compound Name | N-(cyanomethyl)-N'-cyclopropyl-N'-methyloxamide |
|---|---|
| PubChem CID | 43316269 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(cyanomethyl)-N'-cyclopropyl-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)NCC#N)C1CC1 |
| InChI | InChI=1S/C8H11N3O2/c1-11(6-2-3-6)8(13)7(12)10-5-4-9/h6H,2-3,5H2,1H3,(H,10,12) |
| InChIKey | VHYFSCJHWRCTFG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|