C10H16N4O2 — CID 62978700
N'-(cyanomethyl)-N-[2-[cyclopropyl(methyl)amino]ethyl]oxamide (PubChem CID 62978700) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N'-(cyanomethyl)-N-[2-[cyclopropyl(methyl)amino]ethyl]oxamide.
| Compound Name | N'-(cyanomethyl)-N-[2-[cyclopropyl(methyl)amino]ethyl]oxamide |
|---|---|
| PubChem CID | 62978700 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-(cyanomethyl)-N-[2-[cyclopropyl(methyl)amino]ethyl]oxamide |
| SMILES | CN(CCNC(=O)C(=O)NCC#N)C1CC1 |
| InChI | InChI=1S/C10H16N4O2/c1-14(8-2-3-8)7-6-13-10(16)9(15)12-5-4-11/h8H,2-3,5-7H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | HSBFWFRFTLFDAZ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|