C10H19N3O2 — CID 61439009
2-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)-2-oxoacetamide (PubChem CID 61439009) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)-2-oxoacetamide.
| Compound Name | 2-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 61439009 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)-2-oxoacetamide |
| SMILES | CC1CCC(N(C)C(=O)C(=O)NN)CC1 |
| InChI | InChI=1S/C10H19N3O2/c1-7-3-5-8(6-4-7)13(2)10(15)9(14)12-11/h7-8H,3-6,11H2,1-2H3,(H,12,14) |
| InChIKey | XUXRTDVTEURQAK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|