C11H17N3O3 — CID 54999160
N-(cyanomethyl)-N'-cyclopentyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 54999160) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-cyclopentyl-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-cyclopentyl-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 54999160 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(cyanomethyl)-N'-cyclopentyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)N(CCO)C1CCCC1 |
| InChI | InChI=1S/C11H17N3O3/c12-5-6-13-10(16)11(17)14(7-8-15)9-3-1-2-4-9/h9,15H,1-4,6-8H2,(H,13,16) |
| InChIKey | RRFQKYIMUARFLA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|