About N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide
N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide (PubChem CID 64591948) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide |
| PubChem CID | 64591948 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide |
| SMILES | CCCCN(C(=O)C(=O)NCC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O2S/c1-2-3-9-17(11-7-5-4-6-8-11)14(19)13(18)16-10-12(15)20/h4-8H,2-3,9-10H2,1H3,(H2,15,20)(H,16,18) |
| InChIKey | WBTICKWSUXPELM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide?
The IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide (CID 64591948) is N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide.
What is the SMILES notation for N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide?
The canonical SMILES for N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide is CCCCN(C(=O)C(=O)NCC(N)=S)c1ccccc1.
What is the InChIKey of N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide?
The InChIKey is WBTICKWSUXPELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c1-2-3-9-17(11-7-5-4-6-8-11)14(19)13(18)16-10-12(15)20/h4-8H,2-3,9-10H2,1H3,(H2,15,20)(H,16,18).
What are the key properties of N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide?
N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide has a molecular weight of 293.39 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-sulfanylideneethyl)-N'-butyl-N'-phenyloxamide is sourced from PubChem (CID 64591948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).