About octyl(phenyl)carbamic acid
octyl(phenyl)carbamic acid (PubChem CID 54301990) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is octyl(phenyl)carbamic acid.
Molecular Properties
| Compound Name | octyl(phenyl)carbamic acid |
| PubChem CID | 54301990 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | octyl(phenyl)carbamic acid |
| SMILES | CCCCCCCCN(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-6-10-13-16(15(17)18)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3,(H,17,18) |
| InChIKey | SEWJXBVXGXZTFG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl(phenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl(phenyl)carbamic acid?
The IUPAC name of octyl(phenyl)carbamic acid (CID 54301990) is octyl(phenyl)carbamic acid.
What is the SMILES notation for octyl(phenyl)carbamic acid?
The canonical SMILES for octyl(phenyl)carbamic acid is CCCCCCCCN(C(=O)O)c1ccccc1.
What is the InChIKey of octyl(phenyl)carbamic acid?
The InChIKey is SEWJXBVXGXZTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-2-3-4-5-6-10-13-16(15(17)18)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3,(H,17,18).
What are the key properties of octyl(phenyl)carbamic acid?
octyl(phenyl)carbamic acid has a molecular weight of 249.35 g/mol, XLogP of 4.53, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octyl(phenyl)carbamic acid is sourced from PubChem (CID 54301990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).