C18H19F2NO — CID 135075330
2,6-difluoro-N-pentyl-N-phenylbenzamide (PubChem CID 135075330) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is 2,6-difluoro-N-pentyl-N-phenylbenzamide.
| Compound Name | 2,6-difluoro-N-pentyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 135075330 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2,6-difluoro-N-pentyl-N-phenylbenzamide |
| SMILES | CCCCCN(C(=O)c1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H19F2NO/c1-2-3-7-13-21(14-9-5-4-6-10-14)18(22)17-15(19)11-8-12-16(17)20/h4-6,8-12H,2-3,7,13H2,1H3 |
| InChIKey | SNEYDQFWQQAROK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|