C13H16BrF2NO — CID 80658889
N-(2-bromoethyl)-N-butyl-2,6-difluorobenzamide (PubChem CID 80658889) has the molecular formula C13H16BrF2NO and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-butyl-2,6-difluorobenzamide.
| Compound Name | N-(2-bromoethyl)-N-butyl-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 80658889 |
| Molecular Formula | C13H16BrF2NO |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(2-bromoethyl)-N-butyl-2,6-difluorobenzamide |
| SMILES | CCCCN(CCBr)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H16BrF2NO/c1-2-3-8-17(9-7-14)13(18)12-10(15)5-4-6-11(12)16/h4-6H,2-3,7-9H2,1H3 |
| InChIKey | WQAMZLIIGUBWMC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|