About N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide
N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 108524636) has the molecular formula C13H27N3O3
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide.
Molecular Properties
| Compound Name | N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
| PubChem CID | 108524636 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | CCN(CC)CCCNC(=O)C(=O)N(CC)CCO |
| InChI | InChI=1S/C13H27N3O3/c1-4-15(5-2)9-7-8-14-12(18)13(19)16(6-3)10-11-17/h17H,4-11H2,1-3H3,(H,14,18) |
| InChIKey | TVQAHQJZDKJPQC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide?
The IUPAC name of N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide (CID 108524636) is N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide.
What is the SMILES notation for N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide?
The canonical SMILES for N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide is CCN(CC)CCCNC(=O)C(=O)N(CC)CCO.
What is the InChIKey of N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide?
The InChIKey is TVQAHQJZDKJPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O3/c1-4-15(5-2)9-7-8-14-12(18)13(19)16(6-3)10-11-17/h17H,4-11H2,1-3H3,(H,14,18).
What are the key properties of N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide?
N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide has a molecular weight of 273.38 g/mol, XLogP of -0.32, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(diethylamino)propyl]-N'-ethyl-N'-(2-hydroxyethyl)oxamide is sourced from PubChem (CID 108524636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).