C12H24N2O3 — CID 108524538
N',N'-dibutyl-N-(2-hydroxyethyl)oxamide (PubChem CID 108524538) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N',N'-dibutyl-N-(2-hydroxyethyl)oxamide.
| Compound Name | N',N'-dibutyl-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108524538 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N',N'-dibutyl-N-(2-hydroxyethyl)oxamide |
| SMILES | CCCCN(CCCC)C(=O)C(=O)NCCO |
| InChI | InChI=1S/C12H24N2O3/c1-3-5-8-14(9-6-4-2)12(17)11(16)13-7-10-15/h15H,3-10H2,1-2H3,(H,13,16) |
| InChIKey | JWBCBNZFNCHNMG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|