C14H28N2O3 — CID 108525120
N'-ethyl-N'-(2-hydroxyethyl)-N-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108525120) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-ethyl-N'-(2-hydroxyethyl)-N-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108525120 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-7-16(8-9-17)12(19)11(18)15-14(5,6)10-13(2,3)4/h17H,7-10H2,1-6H3,(H,15,18) |
| InChIKey | CPEFEDBAHQVZGZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|