C15H32N2O — CID 3031109
2-(diethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 3031109) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | 2-(diethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 3031109 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 2-(diethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CCN(CC)C(C)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H32N2O/c1-9-17(10-2)12(3)13(18)16-15(7,8)11-14(4,5)6/h12H,9-11H2,1-8H3,(H,16,18) |
| InChIKey | KJLYRCWOVJIAAM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |