C13H27NO — CID 17381763
3-methyl-N-(2,4,4-trimethylpentan-2-yl)butanamide (PubChem CID 17381763) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-methyl-N-(2,4,4-trimethylpentan-2-yl)butanamide.
| Compound Name | 3-methyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 17381763 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-methyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
| SMILES | CC(C)CC(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-10(2)8-11(15)14-13(6,7)9-12(3,4)5/h10H,8-9H2,1-7H3,(H,14,15) |
| InChIKey | IUMVCUNVJXQNHP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |