C14H27N3O3 — CID 174253656
N-formyl-2,4-dimethyl-2-(methylamino)-4-(3-methylbutanoylamino)pentanamide (PubChem CID 174253656) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-formyl-2,4-dimethyl-2-(methylamino)-4-(3-methylbutanoylamino)pentanamide.
| Compound Name | N-formyl-2,4-dimethyl-2-(methylamino)-4-(3-methylbutanoylamino)pentanamide |
|---|---|
| PubChem CID | 174253656 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-formyl-2,4-dimethyl-2-(methylamino)-4-(3-methylbutanoylamino)pentanamide |
| SMILES | CNC(C)(CC(C)(C)NC(=O)CC(C)C)C(=O)NC=O |
| InChI | InChI=1S/C14H27N3O3/c1-10(2)7-11(19)17-13(3,4)8-14(5,15-6)12(20)16-9-18/h9-10,15H,7-8H2,1-6H3,(H,17,19)(H,16,18,20) |
| InChIKey | MDHMUARPWZKVGE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|